About (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol
(1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol (PubChem CID 164638336) has the molecular formula C12H12F2N2O3S
and a molecular weight of 302.30 g/mol. Its IUPAC name is (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol |
| PubChem CID | 164638336 |
| Molecular Formula | C12H12F2N2O3S |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol |
| SMILES | CS(=O)(=O)c1cnn(C[C@H](O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C12H12F2N2O3S/c1-20(18,19)9-5-15-16(6-9)7-12(17)8-2-3-10(13)11(14)4-8/h2-6,12,17H,7H2,1H3/t12-/m0/s1 |
| InChIKey | WILZQCRUWGOAFA-LBPRGKRZSA-N |
| XLogP | 1.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol?
The IUPAC name of (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol (CID 164638336) is (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol.
What is the SMILES notation for (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol?
The canonical SMILES for (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol is CS(=O)(=O)c1cnn(C[C@H](O)c2ccc(F)c(F)c2)c1.
What is the InChIKey of (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol?
The InChIKey is WILZQCRUWGOAFA-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H12F2N2O3S/c1-20(18,19)9-5-15-16(6-9)7-12(17)8-2-3-10(13)11(14)4-8/h2-6,12,17H,7H2,1H3/t12-/m0/s1.
What are the key properties of (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol?
(1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol has a molecular weight of 302.30 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(3,4-difluorophenyl)-2-(4-methylsulfonylpyrazol-1-yl)ethanol is sourced from PubChem (CID 164638336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).