C20H29N3O3 — CID 164638428
(4aR,8aS)-1-butyl-6-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 164638428) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4aR,8aS)-1-butyl-6-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-butyl-6-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 164638428 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (4aR,8aS)-1-butyl-6-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCCN1C(=O)CC[C@@H]2CN(C(=O)c3onc4c3CCCC4)CC[C@@H]21 |
| InChI | InChI=1S/C20H29N3O3/c1-2-3-11-23-17-10-12-22(13-14(17)8-9-18(23)24)20(25)19-15-6-4-5-7-16(15)21-26-19/h14,17H,2-13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | VUFAUXQSGLPUMY-PBHICJAKSA-N |
| XLogP | 2.81 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |