C15H20N4O — CID 164638458
(2S)-N-(2-imidazo[1,2-a]pyrimidin-2-ylethyl)-2,4-dimethylpent-4-enamide (PubChem CID 164638458) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-N-(2-imidazo[1,2-a]pyrimidin-2-ylethyl)-2,4-dimethylpent-4-enamide.
| Compound Name | (2S)-N-(2-imidazo[1,2-a]pyrimidin-2-ylethyl)-2,4-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 164638458 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2S)-N-(2-imidazo[1,2-a]pyrimidin-2-ylethyl)-2,4-dimethylpent-4-enamide |
| SMILES | C=C(C)C[C@H](C)C(=O)NCCc1cn2cccnc2n1 |
| InChI | InChI=1S/C15H20N4O/c1-11(2)9-12(3)14(20)16-7-5-13-10-19-8-4-6-17-15(19)18-13/h4,6,8,10,12H,1,5,7,9H2,2-3H3,(H,16,20)/t12-/m0/s1 |
| InChIKey | LHBWCYSPQRQAJA-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|