About N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide
N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide (PubChem CID 164638460) has the molecular formula C17H22Cl2N2O3
and a molecular weight of 373.28 g/mol. Its IUPAC name is N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide |
| PubChem CID | 164638460 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)N1CCC(COc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-11(20-12(2)22)17(23)21-5-3-13(4-6-21)10-24-16-8-14(18)7-15(19)9-16/h7-9,11,13H,3-6,10H2,1-2H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | UDMHXTQWYMWTKE-NSHDSACASA-N |
| XLogP | 3.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide?
The IUPAC name of N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide (CID 164638460) is N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide.
What is the SMILES notation for N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide?
The canonical SMILES for N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide is CC(=O)N[C@@H](C)C(=O)N1CCC(COc2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide?
The InChIKey is UDMHXTQWYMWTKE-NSHDSACASA-N. The full InChI is InChI=1S/C17H22Cl2N2O3/c1-11(20-12(2)22)17(23)21-5-3-13(4-6-21)10-24-16-8-14(18)7-15(19)9-16/h7-9,11,13H,3-6,10H2,1-2H3,(H,20,22)/t11-/m0/s1.
What are the key properties of N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide?
N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide has a molecular weight of 373.28 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-[4-[(3,5-dichlorophenoxy)methyl]piperidin-1-yl]-1-oxopropan-2-yl]acetamide is sourced from PubChem (CID 164638460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).