About (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone
(2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone (PubChem CID 164638477) has the molecular formula C13H19F2N3O2
and a molecular weight of 287.31 g/mol. Its IUPAC name is (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone |
| PubChem CID | 164638477 |
| Molecular Formula | C13H19F2N3O2 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone |
| SMILES | CC(C)(C)c1nc(C(=O)N2CCNC[C@H]2C(F)F)co1 |
| InChI | InChI=1S/C13H19F2N3O2/c1-13(2,3)12-17-8(7-20-12)11(19)18-5-4-16-6-9(18)10(14)15/h7,9-10,16H,4-6H2,1-3H3/t9-/m0/s1 |
| InChIKey | XEILGXNUOQOYNY-VIFPVBQESA-N |
| XLogP | 1.65 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone?
The IUPAC name of (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone (CID 164638477) is (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone.
What is the SMILES notation for (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone?
The canonical SMILES for (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone is CC(C)(C)c1nc(C(=O)N2CCNC[C@H]2C(F)F)co1.
What is the InChIKey of (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone?
The InChIKey is XEILGXNUOQOYNY-VIFPVBQESA-N. The full InChI is InChI=1S/C13H19F2N3O2/c1-13(2,3)12-17-8(7-20-12)11(19)18-5-4-16-6-9(18)10(14)15/h7,9-10,16H,4-6H2,1-3H3/t9-/m0/s1.
What are the key properties of (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone?
(2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone has a molecular weight of 287.31 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-1,3-oxazol-4-yl)-[(2S)-2-(difluoromethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 164638477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).