About (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide
(3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide (PubChem CID 164638502) has the molecular formula C15H17N3O3S2
and a molecular weight of 351.45 g/mol. Its IUPAC name is (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide.
Molecular Properties
| Compound Name | (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide |
| PubChem CID | 164638502 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)[C@H]1CCCN(C(=O)c2cc(-c3ccccc3)ns2)C1 |
| InChI | InChI=1S/C15H17N3O3S2/c16-23(20,21)12-7-4-8-18(10-12)15(19)14-9-13(17-22-14)11-5-2-1-3-6-11/h1-3,5-6,9,12H,4,7-8,10H2,(H2,16,20,21)/t12-/m0/s1 |
| InChIKey | BRSYPFYHOUFFDN-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide?
The IUPAC name of (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide (CID 164638502) is (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide.
What is the SMILES notation for (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide?
The canonical SMILES for (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide is NS(=O)(=O)[C@H]1CCCN(C(=O)c2cc(-c3ccccc3)ns2)C1.
What is the InChIKey of (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide?
The InChIKey is BRSYPFYHOUFFDN-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H17N3O3S2/c16-23(20,21)12-7-4-8-18(10-12)15(19)14-9-13(17-22-14)11-5-2-1-3-6-11/h1-3,5-6,9,12H,4,7-8,10H2,(H2,16,20,21)/t12-/m0/s1.
What are the key properties of (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide?
(3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide has a molecular weight of 351.45 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(3-phenyl-1,2-thiazole-5-carbonyl)piperidine-3-sulfonamide is sourced from PubChem (CID 164638502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).