About 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole
3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole (PubChem CID 164638529) has the molecular formula C12H12ClFN4O
and a molecular weight of 282.71 g/mol. Its IUPAC name is 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole |
| PubChem CID | 164638529 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc([C@@H]2CCCN2c2ncc(Cl)cc2F)no1 |
| InChI | InChI=1S/C12H12ClFN4O/c1-7-16-11(17-19-7)10-3-2-4-18(10)12-9(14)5-8(13)6-15-12/h5-6,10H,2-4H2,1H3/t10-/m0/s1 |
| InChIKey | HDLNXCYWVQSKDF-JTQLQIEISA-N |
| XLogP | 2.91 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole?
The IUPAC name of 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole (CID 164638529) is 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole?
The canonical SMILES for 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole is Cc1nc([C@@H]2CCCN2c2ncc(Cl)cc2F)no1.
What is the InChIKey of 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole?
The InChIKey is HDLNXCYWVQSKDF-JTQLQIEISA-N. The full InChI is InChI=1S/C12H12ClFN4O/c1-7-16-11(17-19-7)10-3-2-4-18(10)12-9(14)5-8(13)6-15-12/h5-6,10H,2-4H2,1H3/t10-/m0/s1.
What are the key properties of 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole?
3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole has a molecular weight of 282.71 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-1-(5-chloro-3-fluoro-2-pyridinyl)pyrrolidin-2-yl]-5-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 164638529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).