About N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide
N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide (PubChem CID 164638542) has the molecular formula C17H27N3O3S
and a molecular weight of 353.49 g/mol. Its IUPAC name is N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide |
| PubChem CID | 164638542 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide |
| SMILES | Cn1cc(CCC(=O)N(C2CCCCC2)[C@H]2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C17H27N3O3S/c1-19-12-14(11-18-19)7-8-17(21)20(15-5-3-2-4-6-15)16-9-10-24(22,23)13-16/h11-12,15-16H,2-10,13H2,1H3/t16-/m0/s1 |
| InChIKey | BPCGXDVNFDJBDI-INIZCTEOSA-N |
| XLogP | 1.70 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide?
The IUPAC name of N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide (CID 164638542) is N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide.
What is the SMILES notation for N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide?
The canonical SMILES for N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide is Cn1cc(CCC(=O)N(C2CCCCC2)[C@H]2CCS(=O)(=O)C2)cn1.
What is the InChIKey of N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide?
The InChIKey is BPCGXDVNFDJBDI-INIZCTEOSA-N. The full InChI is InChI=1S/C17H27N3O3S/c1-19-12-14(11-18-19)7-8-17(21)20(15-5-3-2-4-6-15)16-9-10-24(22,23)13-16/h11-12,15-16H,2-10,13H2,1H3/t16-/m0/s1.
What are the key properties of N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide?
N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide has a molecular weight of 353.49 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-methylpyrazol-4-yl)propanamide is sourced from PubChem (CID 164638542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).