C18H22N2O3 — CID 164638599
[4-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 164638599) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [4-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 164638599 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [4-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | CC[C@H]1C=CCN1C(=O)c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-16-4-3-9-20(16)18(22)15-7-5-14(6-8-15)17(21)19-10-12-23-13-11-19/h3-8,16H,2,9-13H2,1H3/t16-/m0/s1 |
| InChIKey | YITSGFMKDLMRMU-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|