About (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide
(3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide (PubChem CID 164638683) has the molecular formula C16H17FN4O2S
and a molecular weight of 348.40 g/mol. Its IUPAC name is (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide |
| PubChem CID | 164638683 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide |
| SMILES | C[C@]1(C(N)=O)CCN(C(=O)c2ccc(Nc3nccs3)cc2F)C1 |
| InChI | InChI=1S/C16H17FN4O2S/c1-16(14(18)23)4-6-21(9-16)13(22)11-3-2-10(8-12(11)17)20-15-19-5-7-24-15/h2-3,5,7-8H,4,6,9H2,1H3,(H2,18,23)(H,19,20)/t16-/m0/s1 |
| InChIKey | QNQXVKPWSSFYFK-INIZCTEOSA-N |
| XLogP | 2.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide?
The IUPAC name of (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide (CID 164638683) is (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide.
What is the SMILES notation for (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide?
The canonical SMILES for (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide is C[C@]1(C(N)=O)CCN(C(=O)c2ccc(Nc3nccs3)cc2F)C1.
What is the InChIKey of (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide?
The InChIKey is QNQXVKPWSSFYFK-INIZCTEOSA-N. The full InChI is InChI=1S/C16H17FN4O2S/c1-16(14(18)23)4-6-21(9-16)13(22)11-3-2-10(8-12(11)17)20-15-19-5-7-24-15/h2-3,5,7-8H,4,6,9H2,1H3,(H2,18,23)(H,19,20)/t16-/m0/s1.
What are the key properties of (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide?
(3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide has a molecular weight of 348.40 g/mol, XLogP of 2.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[2-fluoro-4-(1,3-thiazol-2-ylamino)benzoyl]-3-methylpyrrolidine-3-carboxamide is sourced from PubChem (CID 164638683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).