About N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide
N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide (PubChem CID 164638710) has the molecular formula C13H20N2O5
and a molecular weight of 284.31 g/mol. Its IUPAC name is N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide |
| PubChem CID | 164638710 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide |
| SMILES | COc1cc(C(=O)N[C@@H](CCO)C2CCOCC2)on1 |
| InChI | InChI=1S/C13H20N2O5/c1-18-12-8-11(20-15-12)13(17)14-10(2-5-16)9-3-6-19-7-4-9/h8-10,16H,2-7H2,1H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | NSDIZIKJLOODGT-JTQLQIEISA-N |
| XLogP | 0.59 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide (CID 164638710) is N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide is COc1cc(C(=O)N[C@@H](CCO)C2CCOCC2)on1.
What is the InChIKey of N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide?
The InChIKey is NSDIZIKJLOODGT-JTQLQIEISA-N. The full InChI is InChI=1S/C13H20N2O5/c1-18-12-8-11(20-15-12)13(17)14-10(2-5-16)9-3-6-19-7-4-9/h8-10,16H,2-7H2,1H3,(H,14,17)/t10-/m0/s1.
What are the key properties of N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide?
N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide has a molecular weight of 284.31 g/mol, XLogP of 0.59, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-3-hydroxy-1-(oxan-4-yl)propyl]-3-methoxy-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 164638710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).