About 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile
4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile (PubChem CID 164638827) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile |
| PubChem CID | 164638827 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile |
| SMILES | CO[C@H]1CN(c2cc(Cl)ccc2C#N)C[C@@H]1O |
| InChI | InChI=1S/C12H13ClN2O2/c1-17-12-7-15(6-11(12)16)10-4-9(13)3-2-8(10)5-14/h2-4,11-12,16H,6-7H2,1H3/t11-,12-/m0/s1 |
| InChIKey | VRYJCTSQCFHNGI-RYUDHWBXSA-N |
| XLogP | 1.41 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile?
The IUPAC name of 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile (CID 164638827) is 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile.
What is the SMILES notation for 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile?
The canonical SMILES for 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile is CO[C@H]1CN(c2cc(Cl)ccc2C#N)C[C@@H]1O.
What is the InChIKey of 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile?
The InChIKey is VRYJCTSQCFHNGI-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H13ClN2O2/c1-17-12-7-15(6-11(12)16)10-4-9(13)3-2-8(10)5-14/h2-4,11-12,16H,6-7H2,1H3/t11-,12-/m0/s1.
What are the key properties of 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile?
4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile has a molecular weight of 252.70 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(3S,4S)-3-hydroxy-4-methoxypyrrolidin-1-yl]benzonitrile is sourced from PubChem (CID 164638827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).