C11H15F3N2O3S — CID 164638873
(3R)-3-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)-1,2,4-oxadiazol-3-yl]thiolane 1,1-dioxide (PubChem CID 164638873) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is (3R)-3-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)-1,2,4-oxadiazol-3-yl]thiolane 1,1-dioxide.
| Compound Name | (3R)-3-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)-1,2,4-oxadiazol-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 164638873 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (3R)-3-[5-(3,3,3-trifluoro-2,2-dimethylpropyl)-1,2,4-oxadiazol-3-yl]thiolane 1,1-dioxide |
| SMILES | CC(C)(Cc1nc([C@H]2CCS(=O)(=O)C2)no1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O3S/c1-10(2,11(12,13)14)5-8-15-9(16-19-8)7-3-4-20(17,18)6-7/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | XLRYGVXHKGAVSH-ZETCQYMHSA-N |
| XLogP | 2.10 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |