C15H21F3N4O2 — CID 164638930
(5S,7S)-N-[(1S,2S)-2-hydroxycyclopentyl]-N,5-dimethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 164638930) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is (5S,7S)-N-[(1S,2S)-2-hydroxycyclopentyl]-N,5-dimethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-N-[(1S,2S)-2-hydroxycyclopentyl]-N,5-dimethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 164638930 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (5S,7S)-N-[(1S,2S)-2-hydroxycyclopentyl]-N,5-dimethyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(F)(F)F)n2ncc(C(=O)N(C)[C@H]3CCC[C@@H]3O)c2N1 |
| InChI | InChI=1S/C15H21F3N4O2/c1-8-6-12(15(16,17)18)22-13(20-8)9(7-19-22)14(24)21(2)10-4-3-5-11(10)23/h7-8,10-12,20,23H,3-6H2,1-2H3/t8-,10-,11-,12-/m0/s1 |
| InChIKey | SZLDYQSDJAVRQD-VGDYDELISA-N |
| XLogP | 2.18 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |