C19H26N6O — CID 164639364
(4aR,8aS)-6-(3,6-dimethylpyrazin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 164639364) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is (4aR,8aS)-6-(3,6-dimethylpyrazin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-(3,6-dimethylpyrazin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 164639364 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (4aR,8aS)-6-(3,6-dimethylpyrazin-2-yl)-1-[2-(1H-imidazol-5-yl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1cnc(C)c(N2CC[C@H]3[C@H](CCC(=O)N3CCc3cnc[nH]3)C2)n1 |
| InChI | InChI=1S/C19H26N6O/c1-13-9-21-14(2)19(23-13)24-7-6-17-15(11-24)3-4-18(26)25(17)8-5-16-10-20-12-22-16/h9-10,12,15,17H,3-8,11H2,1-2H3,(H,20,22)/t15-,17+/m1/s1 |
| InChIKey | FKNNAIFDPCOXBX-WBVHZDCISA-N |
| XLogP | 1.88 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |