C20H34N4O2 — CID 164639492
trans-(1S,3R)-1-N-(4,5-diethyl-2-methylpyrazol-3-yl)-3-N-ethyl-1,2,2-trimethylcyclopentane-1,3-dicarboxamide (PubChem CID 164639492) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is trans-(1S,3R)-1-N-(4,5-diethyl-2-methylpyrazol-3-yl)-3-N-ethyl-1,2,2-trimethylcyclopentane-1,3-dicarboxamide.
| Compound Name | trans-(1S,3R)-1-N-(4,5-diethyl-2-methylpyrazol-3-yl)-3-N-ethyl-1,2,2-trimethylcyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 164639492 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | trans-(1S,3R)-1-N-(4,5-diethyl-2-methylpyrazol-3-yl)-3-N-ethyl-1,2,2-trimethylcyclopentane-1,3-dicarboxamide |
| SMILES | CCNC(=O)[C@@H]1CC[C@](C)(C(=O)Nc2c(CC)c(CC)nn2C)C1(C)C |
| InChI | InChI=1S/C20H34N4O2/c1-8-13-15(9-2)23-24(7)16(13)22-18(26)20(6)12-11-14(19(20,4)5)17(25)21-10-3/h14H,8-12H2,1-7H3,(H,21,25)(H,22,26)/t14-,20+/m0/s1 |
| InChIKey | ZFPICIMVIUOFDA-VBKZILBWSA-N |
| XLogP | 3.06 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |