About (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine
(1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine (PubChem CID 164639699) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine.
Molecular Properties
| Compound Name | (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine |
| PubChem CID | 164639699 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine |
| SMILES | CCOCCN[C@@H](C)c1cc2n(n1)CCC2 |
| InChI | InChI=1S/C12H21N3O/c1-3-16-8-6-13-10(2)12-9-11-5-4-7-15(11)14-12/h9-10,13H,3-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | MKHSOIZRWLGIEN-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine?
The IUPAC name of (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine (CID 164639699) is (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine.
What is the SMILES notation for (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine?
The canonical SMILES for (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine is CCOCCN[C@@H](C)c1cc2n(n1)CCC2.
What is the InChIKey of (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine?
The InChIKey is MKHSOIZRWLGIEN-JTQLQIEISA-N. The full InChI is InChI=1S/C12H21N3O/c1-3-16-8-6-13-10(2)12-9-11-5-4-7-15(11)14-12/h9-10,13H,3-8H2,1-2H3/t10-/m0/s1.
What are the key properties of (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine?
(1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine has a molecular weight of 223.32 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)-N-(2-ethoxyethyl)ethanamine is sourced from PubChem (CID 164639699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).