About N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine
N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 164639712) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 164639712 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CN(C[C@H]1CCCOC1)c1nccn2ccnc12 |
| InChI | InChI=1S/C13H18N4O/c1-16(9-11-3-2-8-18-10-11)12-13-15-5-7-17(13)6-4-14-12/h4-7,11H,2-3,8-10H2,1H3/t11-/m1/s1 |
| InChIKey | AXVYMCARKHYDBG-LLVKDONJSA-N |
| XLogP | 1.59 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine (CID 164639712) is N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine is CN(C[C@H]1CCCOC1)c1nccn2ccnc12.
What is the InChIKey of N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is AXVYMCARKHYDBG-LLVKDONJSA-N. The full InChI is InChI=1S/C13H18N4O/c1-16(9-11-3-2-8-18-10-11)12-13-15-5-7-17(13)6-4-14-12/h4-7,11H,2-3,8-10H2,1H3/t11-/m1/s1.
What are the key properties of N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine?
N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 246.31 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[[(3R)-oxan-3-yl]methyl]imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 164639712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).