C18H23N7S — CID 164639720
N,N-dimethyl-3-[[(3S)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 164639720) has the molecular formula C18H23N7S and a molecular weight of 369.50 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(3S)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | N,N-dimethyl-3-[[(3S)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 164639720 |
| Molecular Formula | C18H23N7S |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N,N-dimethyl-3-[[(3S)-3-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CN(C)c1nc(CN2CCC[C@H](c3nc(-c4ccccc4)n[nH]3)C2)ns1 |
| InChI | InChI=1S/C18H23N7S/c1-24(2)18-19-15(23-26-18)12-25-10-6-9-14(11-25)17-20-16(21-22-17)13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12H2,1-2H3,(H,20,21,22)/t14-/m0/s1 |
| InChIKey | HPANVVSIHXFFEJ-AWEZNQCLSA-N |
| XLogP | 2.77 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |