About 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid
2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid (PubChem CID 164639782) has the molecular formula C19H20N2O5S
and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid.
Molecular Properties
| Compound Name | 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid |
| PubChem CID | 164639782 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1ccc(N2CCC[C@@]3(C2)OCc2ccccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H20N2O5S/c20-27(24,25)14-6-7-17(15(10-14)18(22)23)21-9-3-8-19(12-21)16-5-2-1-4-13(16)11-26-19/h1-2,4-7,10H,3,8-9,11-12H2,(H,22,23)(H2,20,24,25)/t19-/m0/s1 |
| InChIKey | BURKEEREDMNNNP-IBGZPJMESA-N |
| XLogP | 2.06 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid?
The IUPAC name of 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid (CID 164639782) is 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid.
What is the SMILES notation for 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid?
The canonical SMILES for 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid is NS(=O)(=O)c1ccc(N2CCC[C@@]3(C2)OCc2ccccc23)c(C(=O)O)c1.
What is the InChIKey of 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid?
The InChIKey is BURKEEREDMNNNP-IBGZPJMESA-N. The full InChI is InChI=1S/C19H20N2O5S/c20-27(24,25)14-6-7-17(15(10-14)18(22)23)21-9-3-8-19(12-21)16-5-2-1-4-13(16)11-26-19/h1-2,4-7,10H,3,8-9,11-12H2,(H,22,23)(H2,20,24,25)/t19-/m0/s1.
What are the key properties of 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid?
2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid has a molecular weight of 388.44 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-spiro[1H-2-benzofuran-3,3'-piperidine]-1'-yl]-5-sulfamoylbenzoic acid is sourced from PubChem (CID 164639782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).