C13H21N3O4 — CID 164639809
(3S,4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylpiperidine-3,4-diol (PubChem CID 164639809) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is (3S,4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylpiperidine-3,4-diol.
| Compound Name | (3S,4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 164639809 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (3S,4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylpiperidine-3,4-diol |
| SMILES | CC[C@]1(O)CCN(c2nc(OC)cc(OC)n2)C[C@@H]1O |
| InChI | InChI=1S/C13H21N3O4/c1-4-13(18)5-6-16(8-9(13)17)12-14-10(19-2)7-11(15-12)20-3/h7,9,17-18H,4-6,8H2,1-3H3/t9-,13-/m0/s1 |
| InChIKey | DLJOUOPZCRHQDZ-ZANVPECISA-N |
| XLogP | 0.21 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |