About 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea
1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea (PubChem CID 164639886) has the molecular formula C14H20F2N4O
and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea.
Molecular Properties
| Compound Name | 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea |
| PubChem CID | 164639886 |
| Molecular Formula | C14H20F2N4O |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea |
| SMILES | CCc1ncc(NC(=O)NCC[C@H]2CCC(F)(F)C2)cn1 |
| InChI | InChI=1S/C14H20F2N4O/c1-2-12-18-8-11(9-19-12)20-13(21)17-6-4-10-3-5-14(15,16)7-10/h8-10H,2-7H2,1H3,(H2,17,20,21)/t10-/m1/s1 |
| InChIKey | OBWSBCCDHMEKLZ-SNVBAGLBSA-N |
| XLogP | 2.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea?
The IUPAC name of 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea (CID 164639886) is 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea.
What is the SMILES notation for 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea?
The canonical SMILES for 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea is CCc1ncc(NC(=O)NCC[C@H]2CCC(F)(F)C2)cn1.
What is the InChIKey of 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea?
The InChIKey is OBWSBCCDHMEKLZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H20F2N4O/c1-2-12-18-8-11(9-19-12)20-13(21)17-6-4-10-3-5-14(15,16)7-10/h8-10H,2-7H2,1H3,(H2,17,20,21)/t10-/m1/s1.
What are the key properties of 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea?
1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea has a molecular weight of 298.34 g/mol, XLogP of 2.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1R)-3,3-difluorocyclopentyl]ethyl]-3-(2-ethylpyrimidin-5-yl)urea is sourced from PubChem (CID 164639886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).