C15H17N3O3 — CID 164640054
N-[[(2R)-oxan-2-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 164640054) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[[(2R)-oxan-2-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-[[(2R)-oxan-2-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 164640054 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[[(2R)-oxan-2-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCCO1)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C15H17N3O3/c19-14(17-9-11-5-2-4-8-21-11)12-10-16-13-6-1-3-7-18(13)15(12)20/h1,3,6-7,10-11H,2,4-5,8-9H2,(H,17,19)/t11-/m1/s1 |
| InChIKey | FKGALBVSJOXRST-LLVKDONJSA-N |
| XLogP | 0.99 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |