C13H20N4O3 — CID 164640236
tert-butyl N-[(3S)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 164640236) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164640236 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | Cn1cc(N2C[C@@H](NC(=O)OC(C)(C)C)CC2=O)cn1 |
| InChI | InChI=1S/C13H20N4O3/c1-13(2,3)20-12(19)15-9-5-11(18)17(7-9)10-6-14-16(4)8-10/h6,8-9H,5,7H2,1-4H3,(H,15,19)/t9-/m0/s1 |
| InChIKey | HOENWPPIYMVVGG-VIFPVBQESA-N |
| XLogP | 1.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |