About N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide
N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide (PubChem CID 164640310) has the molecular formula C19H23NO4S
and a molecular weight of 361.46 g/mol. Its IUPAC name is N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide |
| PubChem CID | 164640310 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide |
| SMILES | CCOc1ccc2c(c1)[C@@H](NS(=O)(=O)Cc1ccccc1C)CCO2 |
| InChI | InChI=1S/C19H23NO4S/c1-3-23-16-8-9-19-17(12-16)18(10-11-24-19)20-25(21,22)13-15-7-5-4-6-14(15)2/h4-9,12,18,20H,3,10-11,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | SXRYCEKRXMRHNB-SFHVURJKSA-N |
| XLogP | 3.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide?
The IUPAC name of N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide (CID 164640310) is N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide.
What is the SMILES notation for N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide?
The canonical SMILES for N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide is CCOc1ccc2c(c1)[C@@H](NS(=O)(=O)Cc1ccccc1C)CCO2.
What is the InChIKey of N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide?
The InChIKey is SXRYCEKRXMRHNB-SFHVURJKSA-N. The full InChI is InChI=1S/C19H23NO4S/c1-3-23-16-8-9-19-17(12-16)18(10-11-24-19)20-25(21,22)13-15-7-5-4-6-14(15)2/h4-9,12,18,20H,3,10-11,13H2,1-2H3/t18-/m0/s1.
What are the key properties of N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide?
N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide has a molecular weight of 361.46 g/mol, XLogP of 3.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-6-ethoxy-3,4-dihydro-2H-chromen-4-yl]-1-(2-methylphenyl)methanesulfonamide is sourced from PubChem (CID 164640310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).