C13H18N4O4 — CID 164640339
2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-(4-ethyl-3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 164640339) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-(4-ethyl-3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-(4-ethyl-3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 164640339 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-(4-ethyl-3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | CCc1c(C)noc1NC(=O)C[C@H]1C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C13H18N4O4/c1-5-8-7(2)15-21-11(8)14-10(18)6-9-12(19)17(4)13(20)16(9)3/h9H,5-6H2,1-4H3,(H,14,18)/t9-/m0/s1 |
| InChIKey | FXYYZFYQNFFSNK-VIFPVBQESA-N |
| XLogP | 0.77 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|