C16H20N4O2S — CID 164640356
N-[(1S,5S,6R,7S)-6-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide (PubChem CID 164640356) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[(1S,5S,6R,7S)-6-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide.
| Compound Name | N-[(1S,5S,6R,7S)-6-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide |
|---|---|
| PubChem CID | 164640356 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(1S,5S,6R,7S)-6-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-oxabicyclo[3.2.0]heptan-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](Nc2ncnc3sc(C)c(C)c23)[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C16H20N4O2S/c1-7-8(2)23-16-11(7)15(17-6-18-16)20-12-10-4-5-22-14(10)13(12)19-9(3)21/h6,10,12-14H,4-5H2,1-3H3,(H,19,21)(H,17,18,20)/t10-,12+,13-,14-/m0/s1 |
| InChIKey | NHYYRYJTBVRNOS-GHYVTOPFSA-N |
| XLogP | 2.01 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |