About (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide
(2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide (PubChem CID 164640482) has the molecular formula C16H24N4O
and a molecular weight of 288.39 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide |
| PubChem CID | 164640482 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide |
| SMILES | C=CC[C@@H]1N(C(=O)Nc2ccnnc2C)CCCC1(C)C |
| InChI | InChI=1S/C16H24N4O/c1-5-7-14-16(3,4)9-6-11-20(14)15(21)18-13-8-10-17-19-12(13)2/h5,8,10,14H,1,6-7,9,11H2,2-4H3,(H,17,18,21)/t14-/m0/s1 |
| InChIKey | OQIWKNIKXLMJAH-AWEZNQCLSA-N |
| XLogP | 3.38 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide?
The IUPAC name of (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide (CID 164640482) is (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide.
What is the SMILES notation for (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide?
The canonical SMILES for (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide is C=CC[C@@H]1N(C(=O)Nc2ccnnc2C)CCCC1(C)C.
What is the InChIKey of (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide?
The InChIKey is OQIWKNIKXLMJAH-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H24N4O/c1-5-7-14-16(3,4)9-6-11-20(14)15(21)18-13-8-10-17-19-12(13)2/h5,8,10,14H,1,6-7,9,11H2,2-4H3,(H,17,18,21)/t14-/m0/s1.
What are the key properties of (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide?
(2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide has a molecular weight of 288.39 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethyl-N-(3-methylpyridazin-4-yl)-2-prop-2-enylpiperidine-1-carboxamide is sourced from PubChem (CID 164640482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).