About (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane
(4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane (PubChem CID 164640513) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane.
Molecular Properties
| Compound Name | (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane |
| PubChem CID | 164640513 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane |
| SMILES | CC[C@H]1CCCN(c2nc(OC)cc(OC)n2)CC1 |
| InChI | InChI=1S/C14H23N3O2/c1-4-11-6-5-8-17(9-7-11)14-15-12(18-2)10-13(16-14)19-3/h10-11H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | LQYGMXKEXKMTKG-NSHDSACASA-N |
| XLogP | 2.51 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane?
The IUPAC name of (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane (CID 164640513) is (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane.
What is the SMILES notation for (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane?
The canonical SMILES for (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane is CC[C@H]1CCCN(c2nc(OC)cc(OC)n2)CC1.
What is the InChIKey of (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane?
The InChIKey is LQYGMXKEXKMTKG-NSHDSACASA-N. The full InChI is InChI=1S/C14H23N3O2/c1-4-11-6-5-8-17(9-7-11)14-15-12(18-2)10-13(16-14)19-3/h10-11H,4-9H2,1-3H3/t11-/m0/s1.
What are the key properties of (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane?
(4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane has a molecular weight of 265.36 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(4,6-dimethoxypyrimidin-2-yl)-4-ethylazepane is sourced from PubChem (CID 164640513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).