C17H21N3O2 — CID 164640533
methyl (7S)-3-[(2-methylphenyl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-7-carboxylate (PubChem CID 164640533) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl (7S)-3-[(2-methylphenyl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-7-carboxylate.
| Compound Name | methyl (7S)-3-[(2-methylphenyl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-7-carboxylate |
|---|---|
| PubChem CID | 164640533 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | methyl (7S)-3-[(2-methylphenyl)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-7-carboxylate |
| SMILES | COC(=O)[C@H]1CCc2nnc(Cc3ccccc3C)n2CC1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-5-3-4-6-14(12)11-16-19-18-15-8-7-13(17(21)22-2)9-10-20(15)16/h3-6,13H,7-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | AAQCMZVIQHLXPK-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |