C21H28N6O3 — CID 164640580
(7S)-7-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one (PubChem CID 164640580) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (7S)-7-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one.
| Compound Name | (7S)-7-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
|---|---|
| PubChem CID | 164640580 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (7S)-7-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methyl-methylamino]-2-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
| SMILES | COc1ccc(-c2[nH]ncc2CN(C)[C@H]2CCc3nn(C)c(=O)n3CC2)cc1OC |
| InChI | InChI=1S/C21H28N6O3/c1-25(16-6-8-19-24-26(2)21(28)27(19)10-9-16)13-15-12-22-23-20(15)14-5-7-17(29-3)18(11-14)30-4/h5,7,11-12,16H,6,8-10,13H2,1-4H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | ACZHOWKPZPROHO-INIZCTEOSA-N |
| XLogP | 1.83 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |