C19H26N4O2S — CID 164640823
(4aS,7aR)-1-benzyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 164640823) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is (4aS,7aR)-1-benzyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-benzyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 164640823 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (4aS,7aR)-1-benzyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1nn(C)cc1CN1CCN(Cc2ccccc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C19H26N4O2S/c1-15-17(11-21(2)20-15)12-23-9-8-22(10-16-6-4-3-5-7-16)18-13-26(24,25)14-19(18)23/h3-7,11,18-19H,8-10,12-14H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | FPGRNYGJNMGJOG-RBUKOAKNSA-N |
| XLogP | 1.21 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |