C17H20FN3O3S — CID 164640825
3-[(2R)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]sulfonyl-5-methylpyridin-2-amine (PubChem CID 164640825) has the molecular formula C17H20FN3O3S and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[(2R)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]sulfonyl-5-methylpyridin-2-amine.
| Compound Name | 3-[(2R)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]sulfonyl-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 164640825 |
| Molecular Formula | C17H20FN3O3S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[(2R)-2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]sulfonyl-5-methylpyridin-2-amine |
| SMILES | Cc1cnc(N)c(S(=O)(=O)N2CCC[C@@H]2COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H20FN3O3S/c1-12-9-16(17(19)20-10-12)25(22,23)21-8-2-3-14(21)11-24-15-6-4-13(18)5-7-15/h4-7,9-10,14H,2-3,8,11H2,1H3,(H2,19,20)/t14-/m1/s1 |
| InChIKey | XFRHZOVKQWMYTK-CQSZACIVSA-N |
| XLogP | 2.34 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |