About N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide
N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide (PubChem CID 164640873) has the molecular formula C20H25N3O2
and a molecular weight of 339.44 g/mol. Its IUPAC name is N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide |
| PubChem CID | 164640873 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide |
| SMILES | C[C@H]1CN(c2ccnc(C(=O)NCc3ccccc3)c2)CC(C)(C)O1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-13-23(14-20(2,3)25-15)17-9-10-21-18(11-17)19(24)22-12-16-7-5-4-6-8-16/h4-11,15H,12-14H2,1-3H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | NEZNPCNGJIHWME-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide?
The IUPAC name of N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide (CID 164640873) is N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide.
What is the SMILES notation for N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide?
The canonical SMILES for N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide is C[C@H]1CN(c2ccnc(C(=O)NCc3ccccc3)c2)CC(C)(C)O1.
What is the InChIKey of N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide?
The InChIKey is NEZNPCNGJIHWME-HNNXBMFYSA-N. The full InChI is InChI=1S/C20H25N3O2/c1-15-13-23(14-20(2,3)25-15)17-9-10-21-18(11-17)19(24)22-12-16-7-5-4-6-8-16/h4-11,15H,12-14H2,1-3H3,(H,22,24)/t15-/m0/s1.
What are the key properties of N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide?
N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide has a molecular weight of 339.44 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[(6S)-2,2,6-trimethylmorpholin-4-yl]pyridine-2-carboxamide is sourced from PubChem (CID 164640873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).