C14H18F3N3O2 — CID 164640892
(2S)-2,4-dimethyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pent-4-enamide (PubChem CID 164640892) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pent-4-enamide.
| Compound Name | (2S)-2,4-dimethyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 164640892 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2S)-2,4-dimethyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pent-4-enamide |
| SMILES | C=C(C)C[C@H](C)C(=O)NCc1ccc(OCC(F)(F)F)nn1 |
| InChI | InChI=1S/C14H18F3N3O2/c1-9(2)6-10(3)13(21)18-7-11-4-5-12(20-19-11)22-8-14(15,16)17/h4-5,10H,1,6-8H2,2-3H3,(H,18,21)/t10-/m0/s1 |
| InChIKey | PKIJOYHIEXWBBE-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|