C16H24N4O4S — CID 164640903
1-[(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-butoxyethanone (PubChem CID 164640903) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-butoxyethanone.
| Compound Name | 1-[(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-butoxyethanone |
|---|---|
| PubChem CID | 164640903 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-[(4aS,7aR)-6,6-dioxo-1-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-butoxyethanone |
| SMILES | CCCCOCC(=O)N1CCN(c2ncccn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H24N4O4S/c1-2-3-9-24-10-15(21)19-7-8-20(16-17-5-4-6-18-16)14-12-25(22,23)11-13(14)19/h4-6,13-14H,2-3,7-12H2,1H3/t13-,14+/m1/s1 |
| InChIKey | STCBBYHRKSXKHN-KGLIPLIRSA-N |
| XLogP | 0.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|