About [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone
[(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone (PubChem CID 164641111) has the molecular formula C15H19N3O3
and a molecular weight of 289.33 g/mol. Its IUPAC name is [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone.
Molecular Properties
| Compound Name | [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone |
| PubChem CID | 164641111 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone |
| SMILES | C[C@H]1CCOCCN1C(=O)c1ccc(-c2cnn(C)c2)o1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-5-7-20-8-6-18(11)15(19)14-4-3-13(21-14)12-9-16-17(2)10-12/h3-4,9-11H,5-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | DLYZNHFMXMAVEJ-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone?
The IUPAC name of [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone (CID 164641111) is [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone.
What is the SMILES notation for [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone?
The canonical SMILES for [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone is C[C@H]1CCOCCN1C(=O)c1ccc(-c2cnn(C)c2)o1.
What is the InChIKey of [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone?
The InChIKey is DLYZNHFMXMAVEJ-NSHDSACASA-N. The full InChI is InChI=1S/C15H19N3O3/c1-11-5-7-20-8-6-18(11)15(19)14-4-3-13(21-14)12-9-16-17(2)10-12/h3-4,9-11H,5-8H2,1-2H3/t11-/m0/s1.
What are the key properties of [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone?
[(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone has a molecular weight of 289.33 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-5-methyl-1,4-oxazepan-4-yl]-[5-(1-methylpyrazol-4-yl)furan-2-yl]methanone is sourced from PubChem (CID 164641111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).