About 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide
4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide (PubChem CID 164641466) has the molecular formula C13H27N3O2S
and a molecular weight of 289.44 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide |
| PubChem CID | 164641466 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide |
| SMILES | CC[C@H]1C[C@@H]1CN1CCN(S(=O)(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O2S/c1-4-12-9-13(12)10-15-5-7-16(8-6-15)19(17,18)14-11(2)3/h11-14H,4-10H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | MPKONZFZKPQVDY-QWHCGFSZSA-N |
| XLogP | 0.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide?
The IUPAC name of 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide (CID 164641466) is 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide.
What is the SMILES notation for 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide?
The canonical SMILES for 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide is CC[C@H]1C[C@@H]1CN1CCN(S(=O)(=O)NC(C)C)CC1.
What is the InChIKey of 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide?
The InChIKey is MPKONZFZKPQVDY-QWHCGFSZSA-N. The full InChI is InChI=1S/C13H27N3O2S/c1-4-12-9-13(12)10-15-5-7-16(8-6-15)19(17,18)14-11(2)3/h11-14H,4-10H2,1-3H3/t12-,13+/m0/s1.
What are the key properties of 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide?
4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide has a molecular weight of 289.44 g/mol, XLogP of 0.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S,2S)-2-ethylcyclopropyl]methyl]-N-propan-2-ylpiperazine-1-sulfonamide is sourced from PubChem (CID 164641466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).