C8H14N4O2S — CID 164641520
N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanesulfonamide (PubChem CID 164641520) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanesulfonamide.
| Compound Name | N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 164641520 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanesulfonamide |
| SMILES | Cc1nc2n(n1)C[C@@H](NS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C8H14N4O2S/c1-6-9-8-4-3-7(5-12(8)10-6)11-15(2,13)14/h7,11H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | BCWJSGJNYOQCJU-ZETCQYMHSA-N |
| XLogP | -0.55 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |