About 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide
5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide (PubChem CID 164641582) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide |
| PubChem CID | 164641582 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)CCCC2=O)c1cncs1 |
| InChI | InChI=1S/C16H16N2O2S/c1-10(15-8-17-9-21-15)18-16(20)12-5-6-13-11(7-12)3-2-4-14(13)19/h5-10H,2-4H2,1H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | DWTXNSPLWNLDDV-JTQLQIEISA-N |
| XLogP | 3.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide?
The IUPAC name of 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide (CID 164641582) is 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide.
What is the SMILES notation for 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide?
The canonical SMILES for 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide is C[C@H](NC(=O)c1ccc2c(c1)CCCC2=O)c1cncs1.
What is the InChIKey of 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide?
The InChIKey is DWTXNSPLWNLDDV-JTQLQIEISA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-10(15-8-17-9-21-15)18-16(20)12-5-6-13-11(7-12)3-2-4-14(13)19/h5-10H,2-4H2,1H3,(H,18,20)/t10-/m0/s1.
What are the key properties of 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide?
5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide has a molecular weight of 300.38 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]-7,8-dihydro-6H-naphthalene-2-carboxamide is sourced from PubChem (CID 164641582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).