About (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone
(2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone (PubChem CID 164642110) has the molecular formula C19H28N2O2S
and a molecular weight of 348.51 g/mol. Its IUPAC name is (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone.
Molecular Properties
| Compound Name | (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone |
| PubChem CID | 164642110 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone |
| SMILES | Cc1nc(C2CCCCC2)sc1C(=O)N1CC[C@H](O)CC12CCC2 |
| InChI | InChI=1S/C19H28N2O2S/c1-13-16(24-17(20-13)14-6-3-2-4-7-14)18(23)21-11-8-15(22)12-19(21)9-5-10-19/h14-15,22H,2-12H2,1H3/t15-/m0/s1 |
| InChIKey | AFYNUSIEHMVCAG-HNNXBMFYSA-N |
| XLogP | 4.02 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone?
The IUPAC name of (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone (CID 164642110) is (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone.
What is the SMILES notation for (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone?
The canonical SMILES for (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone is Cc1nc(C2CCCCC2)sc1C(=O)N1CC[C@H](O)CC12CCC2.
What is the InChIKey of (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone?
The InChIKey is AFYNUSIEHMVCAG-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H28N2O2S/c1-13-16(24-17(20-13)14-6-3-2-4-7-14)18(23)21-11-8-15(22)12-19(21)9-5-10-19/h14-15,22H,2-12H2,1H3/t15-/m0/s1.
What are the key properties of (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone?
(2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone has a molecular weight of 348.51 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-4-methyl-1,3-thiazol-5-yl)-[(8S)-8-hydroxy-5-azaspiro[3.5]nonan-5-yl]methanone is sourced from PubChem (CID 164642110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).