About [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol
[4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol (PubChem CID 164642115) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol |
| PubChem CID | 164642115 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol |
| SMILES | Cc1nnc(CN[C@H](c2ccccc2)C2(CO)CCOCC2)s1 |
| InChI | InChI=1S/C17H23N3O2S/c1-13-19-20-15(23-13)11-18-16(14-5-3-2-4-6-14)17(12-21)7-9-22-10-8-17/h2-6,16,18,21H,7-12H2,1H3/t16-/m1/s1 |
| InChIKey | KXWOFVJPJQHMSZ-MRXNPFEDSA-N |
| XLogP | 2.47 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol?
The IUPAC name of [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol (CID 164642115) is [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol.
What is the SMILES notation for [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol?
The canonical SMILES for [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol is Cc1nnc(CN[C@H](c2ccccc2)C2(CO)CCOCC2)s1.
What is the InChIKey of [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol?
The InChIKey is KXWOFVJPJQHMSZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H23N3O2S/c1-13-19-20-15(23-13)11-18-16(14-5-3-2-4-6-14)17(12-21)7-9-22-10-8-17/h2-6,16,18,21H,7-12H2,1H3/t16-/m1/s1.
What are the key properties of [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol?
[4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol has a molecular weight of 333.46 g/mol, XLogP of 2.47, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(R)-[(5-methyl-1,3,4-thiadiazol-2-yl)methylamino]-phenylmethyl]oxan-4-yl]methanol is sourced from PubChem (CID 164642115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).