C15H19FN2 — CID 164642120
(3aR,6aR)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 164642120) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is (3aR,6aR)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 164642120 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3aR,6aR)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | Fc1ccc(/C=C/CN2CC[C@@H]3CNC[C@@H]32)cc1 |
| InChI | InChI=1S/C15H19FN2/c16-14-5-3-12(4-6-14)2-1-8-18-9-7-13-10-17-11-15(13)18/h1-6,13,15,17H,7-11H2/b2-1+/t13-,15+/m1/s1 |
| InChIKey | NMHATHVAKFFBNG-IDUPTQOLSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |