C14H14ClN5O2 — CID 164642151
5-chloro-6-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]-2-methylpyridine-3-carbonitrile (PubChem CID 164642151) has the molecular formula C14H14ClN5O2 and a molecular weight of 319.75 g/mol. Its IUPAC name is 5-chloro-6-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]-2-methylpyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]-2-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164642151 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 5-chloro-6-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]-2-methylpyridine-3-carbonitrile |
| SMILES | Cc1nc(N2CCC[C@@]3(C2)NC(=O)NC3=O)c(Cl)cc1C#N |
| InChI | InChI=1S/C14H14ClN5O2/c1-8-9(6-16)5-10(15)11(17-8)20-4-2-3-14(7-20)12(21)18-13(22)19-14/h5H,2-4,7H2,1H3,(H2,18,19,21,22)/t14-/m0/s1 |
| InChIKey | VCJFBHPFFBMYQB-AWEZNQCLSA-N |
| XLogP | 1.09 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|