C22H24N4O — CID 164642325
2-[(4aR,8aS)-2-oxo-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-4-carbonitrile (PubChem CID 164642325) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[(4aR,8aS)-2-oxo-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[(4aR,8aS)-2-oxo-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 164642325 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[(4aR,8aS)-2-oxo-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CC[C@H]3[C@H](CCC(=O)N3CCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C22H24N4O/c23-15-18-8-11-24-21(14-18)25-12-10-20-19(16-25)6-7-22(27)26(20)13-9-17-4-2-1-3-5-17/h1-5,8,11,14,19-20H,6-7,9-10,12-13,16H2/t19-,20+/m1/s1 |
| InChIKey | PTLGHDVCRIAFGV-UXHICEINSA-N |
| XLogP | 3.01 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |