C10H15BrN2S — CID 164642382
(1S)-1-(1-bromocyclopropyl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 164642382) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is (1S)-1-(1-bromocyclopropyl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(1-bromocyclopropyl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 164642382 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (1S)-1-(1-bromocyclopropyl)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1ncsc1CN[C@@H](C)C1(Br)CC1 |
| InChI | InChI=1S/C10H15BrN2S/c1-7-9(14-6-13-7)5-12-8(2)10(11)3-4-10/h6,8,12H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | SUYQFWGTYFKURZ-QMMMGPOBSA-N |
| XLogP | 2.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|