About [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone
[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 164642437) has the molecular formula C14H23N3OS
and a molecular weight of 281.42 g/mol. Its IUPAC name is [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 164642437 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | CCC[C@H]1CN(C(=O)c2csc(C)n2)C[C@@H]1N(C)C |
| InChI | InChI=1S/C14H23N3OS/c1-5-6-11-7-17(8-13(11)16(3)4)14(18)12-9-19-10(2)15-12/h9,11,13H,5-8H2,1-4H3/t11-,13-/m0/s1 |
| InChIKey | YJWAXQQPWQZRPR-AAEUAGOBSA-N |
| XLogP | 2.25 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (CID 164642437) is [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone is CCC[C@H]1CN(C(=O)c2csc(C)n2)C[C@@H]1N(C)C.
What is the InChIKey of [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
The InChIKey is YJWAXQQPWQZRPR-AAEUAGOBSA-N. The full InChI is InChI=1S/C14H23N3OS/c1-5-6-11-7-17(8-13(11)16(3)4)14(18)12-9-19-10(2)15-12/h9,11,13H,5-8H2,1-4H3/t11-,13-/m0/s1.
What are the key properties of [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone has a molecular weight of 281.42 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 164642437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).