C20H30N6O — CID 164642490
3-cyclopentyl-7-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 164642490) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-cyclopentyl-7-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-cyclopentyl-7-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 164642490 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 3-cyclopentyl-7-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCn1cc([C@H]2OCC[C@@H]2CN2CCn3c(nnc3C3CCCC3)C2)cn1 |
| InChI | InChI=1S/C20H30N6O/c1-2-25-13-17(11-21-25)19-16(7-10-27-19)12-24-8-9-26-18(14-24)22-23-20(26)15-5-3-4-6-15/h11,13,15-16,19H,2-10,12,14H2,1H3/t16-,19+/m1/s1 |
| InChIKey | WBSBMQBUOODLIF-APWZRJJASA-N |
| XLogP | 2.75 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |