C20H25NO2 — CID 164642605
[(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-(3-phenyl-1-bicyclo[1.1.1]pentanyl)methanone (PubChem CID 164642605) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-(3-phenyl-1-bicyclo[1.1.1]pentanyl)methanone.
| Compound Name | [(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-(3-phenyl-1-bicyclo[1.1.1]pentanyl)methanone |
|---|---|
| PubChem CID | 164642605 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-(3-phenyl-1-bicyclo[1.1.1]pentanyl)methanone |
| SMILES | CC1(C)CN(C(=O)C23CC(c4ccccc4)(C2)C3)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C20H25NO2/c1-18(2)13-21(16-9-23-8-15(16)18)17(22)20-10-19(11-20,12-20)14-6-4-3-5-7-14/h3-7,15-16H,8-13H2,1-2H3/t15-,16+,19?,20?/m1/s1 |
| InChIKey | IMKQFUNCWRYUHJ-ZNVHBHFFSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |