About 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea
1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea (PubChem CID 164642668) has the molecular formula C17H23N5O2
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea.
Molecular Properties
| Compound Name | 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea |
| PubChem CID | 164642668 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea |
| SMILES | Cc1ccnc(-n2nccc2NC(=O)NC[C@H]2CCC(C)(C)O2)c1 |
| InChI | InChI=1S/C17H23N5O2/c1-12-5-8-18-15(10-12)22-14(6-9-20-22)21-16(23)19-11-13-4-7-17(2,3)24-13/h5-6,8-10,13H,4,7,11H2,1-3H3,(H2,19,21,23)/t13-/m1/s1 |
| InChIKey | HVDKMLLTCAMTFW-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea?
The IUPAC name of 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea (CID 164642668) is 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea.
What is the SMILES notation for 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea?
The canonical SMILES for 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea is Cc1ccnc(-n2nccc2NC(=O)NC[C@H]2CCC(C)(C)O2)c1.
What is the InChIKey of 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea?
The InChIKey is HVDKMLLTCAMTFW-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H23N5O2/c1-12-5-8-18-15(10-12)22-14(6-9-20-22)21-16(23)19-11-13-4-7-17(2,3)24-13/h5-6,8-10,13H,4,7,11H2,1-3H3,(H2,19,21,23)/t13-/m1/s1.
What are the key properties of 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea?
1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea has a molecular weight of 329.40 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2R)-5,5-dimethyloxolan-2-yl]methyl]-3-[2-(4-methyl-2-pyridinyl)pyrazol-3-yl]urea is sourced from PubChem (CID 164642668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).